C11H13N3 — CID 21043921
1-cyclopropyl-N-methylbenzimidazol-2-amine (PubChem CID 21043921) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 1-cyclopropyl-N-methylbenzimidazol-2-amine.
| Compound Name | 1-cyclopropyl-N-methylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 21043921 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1-cyclopropyl-N-methylbenzimidazol-2-amine |
| SMILES | CNc1nc2ccccc2n1C1CC1 |
| InChI | InChI=1S/C11H13N3/c1-12-11-13-9-4-2-3-5-10(9)14(11)8-6-7-8/h2-5,8H,6-7H2,1H3,(H,12,13) |
| InChIKey | VLXZZUMKUFVDKD-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |