C22H36OS — CID 144724148
methanethiol;1-methyl-4-[[4-(4-methylcyclohexyl)cyclohexyl]methoxy]benzene (PubChem CID 144724148) has the molecular formula C22H36OS and a molecular weight of 348.60 g/mol. Its IUPAC name is methanethiol;1-methyl-4-[[4-(4-methylcyclohexyl)cyclohexyl]methoxy]benzene.
| Compound Name | methanethiol;1-methyl-4-[[4-(4-methylcyclohexyl)cyclohexyl]methoxy]benzene |
|---|---|
| PubChem CID | 144724148 |
| Molecular Formula | C22H36OS |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | methanethiol;1-methyl-4-[[4-(4-methylcyclohexyl)cyclohexyl]methoxy]benzene |
| SMILES | CS.Cc1ccc(OCC2CCC(C3CCC(C)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H32O.CH4S/c1-16-3-9-19(10-4-16)20-11-7-18(8-12-20)15-22-21-13-5-17(2)6-14-21;1-2/h5-6,13-14,16,18-20H,3-4,7-12,15H2,1-2H3;2H,1H3 |
| InChIKey | PTHWHAOYNCQVKE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|