C29H50O2 — CID 144725593
[7-(2,6-dimethylheptyl)-4a,7-dimethyl-8-propyl-1,2,3,4,4b,5,6,8,8a,9-decahydrophenanthren-2-yl] formate (PubChem CID 144725593) has the molecular formula C29H50O2 and a molecular weight of 430.72 g/mol. Its IUPAC name is [7-(2,6-dimethylheptyl)-4a,7-dimethyl-8-propyl-1,2,3,4,4b,5,6,8,8a,9-decahydrophenanthren-2-yl] formate.
| Compound Name | [7-(2,6-dimethylheptyl)-4a,7-dimethyl-8-propyl-1,2,3,4,4b,5,6,8,8a,9-decahydrophenanthren-2-yl] formate |
|---|---|
| PubChem CID | 144725593 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 430.72 g/mol |
| Exact Mass | 430.38 |
| IUPAC Name | [7-(2,6-dimethylheptyl)-4a,7-dimethyl-8-propyl-1,2,3,4,4b,5,6,8,8a,9-decahydrophenanthren-2-yl] formate |
| SMILES | CCCC1C2CC=C3CC(OC=O)CCC3(C)C2CCC1(C)CC(C)CCCC(C)C |
| InChI | InChI=1S/C29H50O2/c1-7-9-26-25-13-12-23-18-24(31-20-30)14-17-29(23,6)27(25)15-16-28(26,5)19-22(4)11-8-10-21(2)3/h12,20-22,24-27H,7-11,13-19H2,1-6H3 |
| InChIKey | XFKIKUAERREJAM-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.72 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|