C12H16N+ — CID 144727159
1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-2,3-dihydropyridin-1-ium (PubChem CID 144727159) has the molecular formula C12H16N+ and a molecular weight of 174.27 g/mol. Its IUPAC name is 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-2,3-dihydropyridin-1-ium.
| Compound Name | 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-2,3-dihydropyridin-1-ium |
|---|---|
| PubChem CID | 144727159 |
| Molecular Formula | C12H16N+ |
| Molecular Weight | 174.27 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | 1-[(3Z)-5-methylhexa-1,3,5-trien-2-yl]-2,3-dihydropyridin-1-ium |
| SMILES | C=C(C)/C=C\C(=C)[N+]1=CC=CCC1 |
| InChI | InChI=1S/C12H16N/c1-11(2)7-8-12(3)13-9-5-4-6-10-13/h4-5,7-9H,1,3,6,10H2,2H3/q+1/b8-7- |
| InChIKey | COJCTDKSBZDXJP-FPLPWBNLSA-N |
| XLogP | 2.68 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.27 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|