C39H35FN2O5 — CID 144727275
3-[5-[3-(2-bicyclo[2.1.1]hexanylcarbamoyl)phenyl]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]propyl benzoate (PubChem CID 144727275) has the molecular formula C39H35FN2O5 and a molecular weight of 630.72 g/mol. Its IUPAC name is 3-[5-[3-(2-bicyclo[2.1.1]hexanylcarbamoyl)phenyl]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]propyl benzoate.
| Compound Name | 3-[5-[3-(2-bicyclo[2.1.1]hexanylcarbamoyl)phenyl]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]propyl benzoate |
|---|---|
| PubChem CID | 144727275 |
| Molecular Formula | C39H35FN2O5 |
| Molecular Weight | 630.72 g/mol |
| Exact Mass | 630.25 |
| IUPAC Name | 3-[5-[3-(2-bicyclo[2.1.1]hexanylcarbamoyl)phenyl]-2-(4-fluorophenyl)-3-(methylcarbamoyl)-1-benzofuran-6-yl]propyl benzoate |
| SMILES | CNC(=O)c1c(-c2ccc(F)cc2)oc2cc(CCCOC(=O)c3ccccc3)c(-c3cccc(C(=O)NC4CC5CC4C5)c3)cc12 |
| InChI | InChI=1S/C39H35FN2O5/c1-41-38(44)35-32-22-31(26-9-5-10-28(20-26)37(43)42-33-19-23-17-29(33)18-23)27(11-6-16-46-39(45)25-7-3-2-4-8-25)21-34(32)47-36(35)24-12-14-30(40)15-13-24/h2-5,7-10,12-15,20-23,29,33H,6,11,16-19H2,1H3,(H,41,44)(H,42,43) |
| InChIKey | MJDVDYIQJAAQBP-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.72 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|