C14H15N3O2S2 — CID 144728341
6-aminosulfanyl-1H-benzimidazole-2-sulfinic acid;toluene (PubChem CID 144728341) has the molecular formula C14H15N3O2S2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 6-aminosulfanyl-1H-benzimidazole-2-sulfinic acid;toluene.
| Compound Name | 6-aminosulfanyl-1H-benzimidazole-2-sulfinic acid;toluene |
|---|---|
| PubChem CID | 144728341 |
| Molecular Formula | C14H15N3O2S2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 6-aminosulfanyl-1H-benzimidazole-2-sulfinic acid;toluene |
| SMILES | Cc1ccccc1.NSc1ccc2nc(S(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C7H7N3O2S2.C7H8/c8-13-4-1-2-5-6(3-4)10-7(9-5)14(11)12;1-7-5-3-2-4-6-7/h1-3H,8H2,(H,9,10)(H,11,12);2-6H,1H3 |
| InChIKey | BMWADZOTEMLOAJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|