C9H17N3 — CID 144729431
1,4-dimethyl-N-[(Z)-prop-1-enyl]piperazin-2-imine (PubChem CID 144729431) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 1,4-dimethyl-N-[(Z)-prop-1-enyl]piperazin-2-imine.
| Compound Name | 1,4-dimethyl-N-[(Z)-prop-1-enyl]piperazin-2-imine |
|---|---|
| PubChem CID | 144729431 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 1,4-dimethyl-N-[(Z)-prop-1-enyl]piperazin-2-imine |
| SMILES | C/C=C\N=C1/CN(C)CCN1C |
| InChI | InChI=1S/C9H17N3/c1-4-5-10-9-8-11(2)6-7-12(9)3/h4-5H,6-8H2,1-3H3/b5-4-,10-9+ |
| InChIKey | NPIDUTUYYYXCFN-HJXNJETESA-N |
| XLogP | 0.80 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|