C8H14N3+ — CID 91370744
4,7-dimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-4-ium (PubChem CID 91370744) has the molecular formula C8H14N3+ and a molecular weight of 152.22 g/mol. Its IUPAC name is 4,7-dimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-4-ium.
| Compound Name | 4,7-dimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-4-ium |
|---|---|
| PubChem CID | 91370744 |
| Molecular Formula | C8H14N3+ |
| Molecular Weight | 152.22 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 4,7-dimethyl-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-4-ium |
| SMILES | CN1CC[N+]2(C)C=CN=C2C1 |
| InChI | InChI=1S/C8H14N3/c1-10-4-6-11(2)5-3-9-8(11)7-10/h3,5H,4,6-7H2,1-2H3/q+1 |
| InChIKey | XQYLMSYAEKWTES-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.22 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|