C25H26N2O8 — CID 144729757
N-[4-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carbonyl)amino]phenyl]-1,4-dioxo-4a,5,6,7,8,8a-hexahydroisochromene-6-carboxamide (PubChem CID 144729757) has the molecular formula C25H26N2O8 and a molecular weight of 482.49 g/mol. Its IUPAC name is N-[4-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carbonyl)amino]phenyl]-1,4-dioxo-4a,5,6,7,8,8a-hexahydroisochromene-6-carboxamide.
| Compound Name | N-[4-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carbonyl)amino]phenyl]-1,4-dioxo-4a,5,6,7,8,8a-hexahydroisochromene-6-carboxamide |
|---|---|
| PubChem CID | 144729757 |
| Molecular Formula | C25H26N2O8 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-[4-[(1,3-dioxo-3a,4,5,6,7,7a-hexahydro-2-benzofuran-5-carbonyl)amino]phenyl]-1,4-dioxo-4a,5,6,7,8,8a-hexahydroisochromene-6-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=O)C2CCC3C(=O)OC(=O)C3C2)cc1)C1CCC2C(=O)OCC(=O)C2C1 |
| InChI | InChI=1S/C25H26N2O8/c28-20-11-34-23(31)16-7-1-12(9-18(16)20)21(29)26-14-3-5-15(6-4-14)27-22(30)13-2-8-17-19(10-13)25(33)35-24(17)32/h3-6,12-13,16-19H,1-2,7-11H2,(H,26,29)(H,27,30) |
| InChIKey | QFEAIEBALNRVCY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 144.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|