C12H8F3NO4S — CID 54475799
2,4-dioxo-N-[4-(trifluoromethylsulfanyl)phenyl]oxolane-3-carboxamide (PubChem CID 54475799) has the molecular formula C12H8F3NO4S and a molecular weight of 319.26 g/mol. Its IUPAC name is 2,4-dioxo-N-[4-(trifluoromethylsulfanyl)phenyl]oxolane-3-carboxamide.
| Compound Name | 2,4-dioxo-N-[4-(trifluoromethylsulfanyl)phenyl]oxolane-3-carboxamide |
|---|---|
| PubChem CID | 54475799 |
| Molecular Formula | C12H8F3NO4S |
| Molecular Weight | 319.26 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 2,4-dioxo-N-[4-(trifluoromethylsulfanyl)phenyl]oxolane-3-carboxamide |
| SMILES | O=C1COC(=O)C1C(=O)Nc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H8F3NO4S/c13-12(14,15)21-7-3-1-6(2-4-7)16-10(18)9-8(17)5-20-11(9)19/h1-4,9H,5H2,(H,16,18) |
| InChIKey | XLMJVIKGQDMVGL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|