About (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane
(Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane (PubChem CID 144730879) has the molecular formula C13H21F3N4
and a molecular weight of 290.33 g/mol. Its IUPAC name is (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane.
Molecular Properties
| Compound Name | (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane |
| PubChem CID | 144730879 |
| Molecular Formula | C13H21F3N4 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane |
| SMILES | CC.CC(c1ccc(C(F)(F)F)cc1)N(N)/C(N)=C\N |
| InChI | InChI=1S/C11H15F3N4.C2H6/c1-7(18(17)10(16)6-15)8-2-4-9(5-3-8)11(12,13)14;1-2/h2-7H,15-17H2,1H3;1-2H3/b10-6-; |
| InChIKey | RRKKFXKYPYJDPO-OTUCAILMSA-N |
| XLogP | 2.68 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane?
The IUPAC name of (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane (CID 144730879) is (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane.
What is the SMILES notation for (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane?
The canonical SMILES for (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane is CC.CC(c1ccc(C(F)(F)F)cc1)N(N)/C(N)=C\N.
What is the InChIKey of (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane?
The InChIKey is RRKKFXKYPYJDPO-OTUCAILMSA-N. The full InChI is InChI=1S/C11H15F3N4.C2H6/c1-7(18(17)10(16)6-15)8-2-4-9(5-3-8)11(12,13)14;1-2/h2-7H,15-17H2,1H3;1-2H3/b10-6-;.
What are the key properties of (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane?
(Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane has a molecular weight of 290.33 g/mol, XLogP of 2.68, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane is sourced from PubChem (CID 144730879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).