C13H21F3N4 — CID 144730879
(Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane (PubChem CID 144730879) has the molecular formula C13H21F3N4 and a molecular weight of 290.33 g/mol. Its IUPAC name is (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane.
| Compound Name | (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane |
|---|---|
| PubChem CID | 144730879 |
| Molecular Formula | C13H21F3N4 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (Z)-1-[amino-[1-[4-(trifluoromethyl)phenyl]ethyl]amino]ethene-1,2-diamine;ethane |
| SMILES | CC.CC(c1ccc(C(F)(F)F)cc1)N(N)/C(N)=C\N |
| InChI | InChI=1S/C11H15F3N4.C2H6/c1-7(18(17)10(16)6-15)8-2-4-9(5-3-8)11(12,13)14;1-2/h2-7H,15-17H2,1H3;1-2H3/b10-6-; |
| InChIKey | RRKKFXKYPYJDPO-OTUCAILMSA-N |
| XLogP | 2.68 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|