C18H19F3N2O3 — CID 19868741
1-hydroxy-1-[1-[4-[1-[4-(trifluoromethyl)phenyl]ethoxy]phenyl]ethyl]urea (PubChem CID 19868741) has the molecular formula C18H19F3N2O3 and a molecular weight of 368.36 g/mol. Its IUPAC name is 1-hydroxy-1-[1-[4-[1-[4-(trifluoromethyl)phenyl]ethoxy]phenyl]ethyl]urea.
| Compound Name | 1-hydroxy-1-[1-[4-[1-[4-(trifluoromethyl)phenyl]ethoxy]phenyl]ethyl]urea |
|---|---|
| PubChem CID | 19868741 |
| Molecular Formula | C18H19F3N2O3 |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-hydroxy-1-[1-[4-[1-[4-(trifluoromethyl)phenyl]ethoxy]phenyl]ethyl]urea |
| SMILES | CC(Oc1ccc(C(C)N(O)C(N)=O)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N2O3/c1-11(23(25)17(22)24)13-5-9-16(10-6-13)26-12(2)14-3-7-15(8-4-14)18(19,20)21/h3-12,25H,1-2H3,(H2,22,24) |
| InChIKey | HLAXPEKHLRRRDC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|