C18H22N2O3 — CID 88651998
2-[hydroxy-[1-[4-(1-phenylethoxy)phenyl]ethyl]amino]acetamide (PubChem CID 88651998) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is 2-[hydroxy-[1-[4-(1-phenylethoxy)phenyl]ethyl]amino]acetamide.
| Compound Name | 2-[hydroxy-[1-[4-(1-phenylethoxy)phenyl]ethyl]amino]acetamide |
|---|---|
| PubChem CID | 88651998 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 2-[hydroxy-[1-[4-(1-phenylethoxy)phenyl]ethyl]amino]acetamide |
| SMILES | CC(Oc1ccc(C(C)N(O)CC(N)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O3/c1-13(20(22)12-18(19)21)15-8-10-17(11-9-15)23-14(2)16-6-4-3-5-7-16/h3-11,13-14,22H,12H2,1-2H3,(H2,19,21) |
| InChIKey | HNUOVHKZPVGMSK-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|