C18H22N2O2 — CID 70078273
(2S)-2-[[4-(1-phenylethoxy)phenyl]methylamino]propanamide (PubChem CID 70078273) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is (2S)-2-[[4-(1-phenylethoxy)phenyl]methylamino]propanamide.
| Compound Name | (2S)-2-[[4-(1-phenylethoxy)phenyl]methylamino]propanamide |
|---|---|
| PubChem CID | 70078273 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (2S)-2-[[4-(1-phenylethoxy)phenyl]methylamino]propanamide |
| SMILES | CC(Oc1ccc(CN[C@@H](C)C(N)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O2/c1-13(18(19)21)20-12-15-8-10-17(11-9-15)22-14(2)16-6-4-3-5-7-16/h3-11,13-14,20H,12H2,1-2H3,(H2,19,21)/t13-,14?/m0/s1 |
| InChIKey | FSHJUUGBBILVBO-LSLKUGRBSA-N |
| XLogP | 2.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |