C14H19N9O3S2 — CID 144731037
(2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[(6R,7R)-2-[(Z)-N'-hydrazinylcarbamimidoyl]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-methoxyiminoacetamide (PubChem CID 144731037) has the molecular formula C14H19N9O3S2 and a molecular weight of 425.50 g/mol. Its IUPAC name is (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[(6R,7R)-2-[(Z)-N'-hydrazinylcarbamimidoyl]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-methoxyiminoacetamide.
| Compound Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[(6R,7R)-2-[(Z)-N'-hydrazinylcarbamimidoyl]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-methoxyiminoacetamide |
|---|---|
| PubChem CID | 144731037 |
| Molecular Formula | C14H19N9O3S2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (2Z)-2-(2-amino-1,3-thiazol-4-yl)-N-[(6R,7R)-2-[(Z)-N'-hydrazinylcarbamimidoyl]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-methoxyiminoacetamide |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2C(/C(N)=N/NN)=C(C)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C14H19N9O3S2/c1-5-3-27-13-8(12(25)23(13)9(5)10(15)20-22-17)19-11(24)7(21-26-2)6-4-28-14(16)18-6/h4,8,13,22H,3,17H2,1-2H3,(H2,15,20)(H2,16,18)(H,19,24)/b21-7-/t8-,13-/m1/s1 |
| InChIKey | FWFBNCKNNDVXPQ-TZOIXAHNSA-N |
| XLogP | -1.51 |
| TPSA | 186.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|