C9H15F3N4 — CID 144731122
(3Z,5E,7E)-1,1,1-trifluoronona-3,5,7-triene-2,4,5,7-tetramine (PubChem CID 144731122) has the molecular formula C9H15F3N4 and a molecular weight of 236.24 g/mol. Its IUPAC name is (3Z,5E,7E)-1,1,1-trifluoronona-3,5,7-triene-2,4,5,7-tetramine.
| Compound Name | (3Z,5E,7E)-1,1,1-trifluoronona-3,5,7-triene-2,4,5,7-tetramine |
|---|---|
| PubChem CID | 144731122 |
| Molecular Formula | C9H15F3N4 |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (3Z,5E,7E)-1,1,1-trifluoronona-3,5,7-triene-2,4,5,7-tetramine |
| SMILES | C/C=C(N)\C=C(N)/C(N)=C/C(N)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N4/c1-2-5(13)3-6(14)7(15)4-8(16)9(10,11)12/h2-4,8H,13-16H2,1H3/b5-2+,6-3+,7-4- |
| InChIKey | GBPFLTVNMWGFLL-YOPFJTCPSA-N |
| XLogP | 0.42 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|