C8H13F3N2 — CID 163606036
(2E,4Z)-3-(trifluoromethyl)hepta-2,4-diene-1,2-diamine (PubChem CID 163606036) has the molecular formula C8H13F3N2 and a molecular weight of 194.20 g/mol. Its IUPAC name is (2E,4Z)-3-(trifluoromethyl)hepta-2,4-diene-1,2-diamine.
| Compound Name | (2E,4Z)-3-(trifluoromethyl)hepta-2,4-diene-1,2-diamine |
|---|---|
| PubChem CID | 163606036 |
| Molecular Formula | C8H13F3N2 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | (2E,4Z)-3-(trifluoromethyl)hepta-2,4-diene-1,2-diamine |
| SMILES | CC/C=C\C(=C(/N)CN)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2/c1-2-3-4-6(7(13)5-12)8(9,10)11/h3-4H,2,5,12-13H2,1H3/b4-3-,7-6+ |
| InChIKey | HBWJNMSUAACSMG-WWVFNRLHSA-N |
| XLogP | 1.69 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|