C9H13F2N — CID 89205392
(3E,5Z)-4-(difluoromethyl)octa-3,5,7-trien-3-amine (PubChem CID 89205392) has the molecular formula C9H13F2N and a molecular weight of 173.21 g/mol. Its IUPAC name is (3E,5Z)-4-(difluoromethyl)octa-3,5,7-trien-3-amine.
| Compound Name | (3E,5Z)-4-(difluoromethyl)octa-3,5,7-trien-3-amine |
|---|---|
| PubChem CID | 89205392 |
| Molecular Formula | C9H13F2N |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | (3E,5Z)-4-(difluoromethyl)octa-3,5,7-trien-3-amine |
| SMILES | C=C/C=C\C(=C(/N)CC)C(F)F |
| InChI | InChI=1S/C9H13F2N/c1-3-5-6-7(9(10)11)8(12)4-2/h3,5-6,9H,1,4,12H2,2H3/b6-5-,8-7+ |
| InChIKey | WVCGDVAPMJGJPN-IGTJQSIKSA-N |
| XLogP | 2.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|