C22H29N2O2- — CID 144731844
(3R)-3-amino-4-cyclohexyl-1-(1-naphthalen-1-ylethylamino)-1-oxobutan-2-olate (PubChem CID 144731844) has the molecular formula C22H29N2O2- and a molecular weight of 353.49 g/mol. Its IUPAC name is (3R)-3-amino-4-cyclohexyl-1-(1-naphthalen-1-ylethylamino)-1-oxobutan-2-olate.
| Compound Name | (3R)-3-amino-4-cyclohexyl-1-(1-naphthalen-1-ylethylamino)-1-oxobutan-2-olate |
|---|---|
| PubChem CID | 144731844 |
| Molecular Formula | C22H29N2O2- |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | (3R)-3-amino-4-cyclohexyl-1-(1-naphthalen-1-ylethylamino)-1-oxobutan-2-olate |
| SMILES | CC(NC(=O)C([O-])[C@H](N)CC1CCCCC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H29N2O2/c1-15(18-13-7-11-17-10-5-6-12-19(17)18)24-22(26)21(25)20(23)14-16-8-3-2-4-9-16/h5-7,10-13,15-16,20-21H,2-4,8-9,14,23H2,1H3,(H,24,26)/q-1/t15?,20-,21?/m1/s1 |
| InChIKey | IXBQFOBDBODNAI-VZDHWGDASA-N |
| XLogP | 3.04 |
| TPSA | 78.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |