About ethene;methane;2-methylmorpholin-3-one
ethene;methane;2-methylmorpholin-3-one (PubChem CID 144732867) has the molecular formula C8H17NO2
and a molecular weight of 159.23 g/mol. Its IUPAC name is ethene;methane;2-methylmorpholin-3-one.
Molecular Properties
| Compound Name | ethene;methane;2-methylmorpholin-3-one |
| PubChem CID | 144732867 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | ethene;methane;2-methylmorpholin-3-one |
| SMILES | C.C=C.CC1OCCNC1=O |
| InChI | InChI=1S/C5H9NO2.C2H4.CH4/c1-4-5(7)6-2-3-8-4;1-2;/h4H,2-3H2,1H3,(H,6,7);1-2H2;1H4 |
| InChIKey | RSKPIHNOIIGIME-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;methane;2-methylmorpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;methane;2-methylmorpholin-3-one?
The IUPAC name of ethene;methane;2-methylmorpholin-3-one (CID 144732867) is ethene;methane;2-methylmorpholin-3-one.
What is the SMILES notation for ethene;methane;2-methylmorpholin-3-one?
The canonical SMILES for ethene;methane;2-methylmorpholin-3-one is C.C=C.CC1OCCNC1=O.
What is the InChIKey of ethene;methane;2-methylmorpholin-3-one?
The InChIKey is RSKPIHNOIIGIME-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.C2H4.CH4/c1-4-5(7)6-2-3-8-4;1-2;/h4H,2-3H2,1H3,(H,6,7);1-2H2;1H4.
What are the key properties of ethene;methane;2-methylmorpholin-3-one?
ethene;methane;2-methylmorpholin-3-one has a molecular weight of 159.23 g/mol, XLogP of 0.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;methane;2-methylmorpholin-3-one is sourced from PubChem (CID 144732867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).