C26H27F3O — CID 144734075
(2Z)-7,8-difluoro-2-(1-fluoro-2-methylidenebutylidene)-3-methylidene-6-(4-pentylphenyl)-4H-chromene (PubChem CID 144734075) has the molecular formula C26H27F3O and a molecular weight of 412.50 g/mol. Its IUPAC name is (2Z)-7,8-difluoro-2-(1-fluoro-2-methylidenebutylidene)-3-methylidene-6-(4-pentylphenyl)-4H-chromene.
| Compound Name | (2Z)-7,8-difluoro-2-(1-fluoro-2-methylidenebutylidene)-3-methylidene-6-(4-pentylphenyl)-4H-chromene |
|---|---|
| PubChem CID | 144734075 |
| Molecular Formula | C26H27F3O |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | (2Z)-7,8-difluoro-2-(1-fluoro-2-methylidenebutylidene)-3-methylidene-6-(4-pentylphenyl)-4H-chromene |
| SMILES | C=C(CC)/C(F)=C1/Oc2c(cc(-c3ccc(CCCCC)cc3)c(F)c2F)CC1=C |
| InChI | InChI=1S/C26H27F3O/c1-5-7-8-9-18-10-12-19(13-11-18)21-15-20-14-17(4)25(22(27)16(3)6-2)30-26(20)24(29)23(21)28/h10-13,15H,3-9,14H2,1-2H3/b25-22- |
| InChIKey | YNNGQQLHDZGDFG-LVWGJNHUSA-N |
| XLogP | 8.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|