C24H21F3O2 — CID 144733777
(2Z)-6-(4-but-3-enylphenyl)-7,8-difluoro-2-(1-fluoro-2-methoxyprop-2-enylidene)-3-methylidene-4H-chromene (PubChem CID 144733777) has the molecular formula C24H21F3O2 and a molecular weight of 398.42 g/mol. Its IUPAC name is (2Z)-6-(4-but-3-enylphenyl)-7,8-difluoro-2-(1-fluoro-2-methoxyprop-2-enylidene)-3-methylidene-4H-chromene.
| Compound Name | (2Z)-6-(4-but-3-enylphenyl)-7,8-difluoro-2-(1-fluoro-2-methoxyprop-2-enylidene)-3-methylidene-4H-chromene |
|---|---|
| PubChem CID | 144733777 |
| Molecular Formula | C24H21F3O2 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (2Z)-6-(4-but-3-enylphenyl)-7,8-difluoro-2-(1-fluoro-2-methoxyprop-2-enylidene)-3-methylidene-4H-chromene |
| SMILES | C=CCCc1ccc(-c2cc3c(c(F)c2F)O/C(=C(\F)C(=C)OC)C(=C)C3)cc1 |
| InChI | InChI=1S/C24H21F3O2/c1-5-6-7-16-8-10-17(11-9-16)19-13-18-12-14(2)23(20(25)15(3)28-4)29-24(18)22(27)21(19)26/h5,8-11,13H,1-3,6-7,12H2,4H3/b23-20- |
| InChIKey | UYAJMIULUNTDKT-ATJXCDBQSA-N |
| XLogP | 6.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|