C19H26O3 — CID 144734107
1-benzofuran-7-yl 2,4,4-trimethyl-2-propan-2-ylpentanoate (PubChem CID 144734107) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is 1-benzofuran-7-yl 2,4,4-trimethyl-2-propan-2-ylpentanoate.
| Compound Name | 1-benzofuran-7-yl 2,4,4-trimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 144734107 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 1-benzofuran-7-yl 2,4,4-trimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)C(C)(CC(C)(C)C)C(=O)Oc1cccc2ccoc12 |
| InChI | InChI=1S/C19H26O3/c1-13(2)19(6,12-18(3,4)5)17(20)22-15-9-7-8-14-10-11-21-16(14)15/h7-11,13H,12H2,1-6H3 |
| InChIKey | WCUJZLBFLAPICV-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|