C23H23N5O3 — CID 144734852
N-(4,6-dimethyl-2-pyridinyl)-6-[2-(3-hydroxypropoxy)phenyl]imidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 144734852) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-(4,6-dimethyl-2-pyridinyl)-6-[2-(3-hydroxypropoxy)phenyl]imidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | N-(4,6-dimethyl-2-pyridinyl)-6-[2-(3-hydroxypropoxy)phenyl]imidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 144734852 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-(4,6-dimethyl-2-pyridinyl)-6-[2-(3-hydroxypropoxy)phenyl]imidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | Cc1cc(C)nc(NC(=O)c2cnc3ccc(-c4ccccc4OCCCO)nn23)c1 |
| InChI | InChI=1S/C23H23N5O3/c1-15-12-16(2)25-21(13-15)26-23(30)19-14-24-22-9-8-18(27-28(19)22)17-6-3-4-7-20(17)31-11-5-10-29/h3-4,6-9,12-14,29H,5,10-11H2,1-2H3,(H,25,26,30) |
| InChIKey | ZBSPKDJXLFOAHI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|