C22H21N5O3 — CID 123761197
6-[2-(3-hydroxypropoxy)phenyl]-2-methyl-N-pyridin-2-ylimidazo[1,2-b]pyridazine-3-carboxamide (PubChem CID 123761197) has the molecular formula C22H21N5O3 and a molecular weight of 403.44 g/mol. Its IUPAC name is 6-[2-(3-hydroxypropoxy)phenyl]-2-methyl-N-pyridin-2-ylimidazo[1,2-b]pyridazine-3-carboxamide.
| Compound Name | 6-[2-(3-hydroxypropoxy)phenyl]-2-methyl-N-pyridin-2-ylimidazo[1,2-b]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 123761197 |
| Molecular Formula | C22H21N5O3 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 6-[2-(3-hydroxypropoxy)phenyl]-2-methyl-N-pyridin-2-ylimidazo[1,2-b]pyridazine-3-carboxamide |
| SMILES | Cc1nc2ccc(-c3ccccc3OCCCO)nn2c1C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C22H21N5O3/c1-15-21(22(29)25-19-9-4-5-12-23-19)27-20(24-15)11-10-17(26-27)16-7-2-3-8-18(16)30-14-6-13-28/h2-5,7-12,28H,6,13-14H2,1H3,(H,23,25,29) |
| InChIKey | RKSZGARSTHAAFY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|