C26H28F3N3O6 — CID 144735318
ethane;N-[(2-methyl-1,3-dioxoisoindol-5-yl)methyl]-4-(trifluoromethoxy)benzamide;(3R)-3-methylpiperidine-2,6-dione (PubChem CID 144735318) has the molecular formula C26H28F3N3O6 and a molecular weight of 535.52 g/mol. Its IUPAC name is ethane;N-[(2-methyl-1,3-dioxoisoindol-5-yl)methyl]-4-(trifluoromethoxy)benzamide;(3R)-3-methylpiperidine-2,6-dione.
| Compound Name | ethane;N-[(2-methyl-1,3-dioxoisoindol-5-yl)methyl]-4-(trifluoromethoxy)benzamide;(3R)-3-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 144735318 |
| Molecular Formula | C26H28F3N3O6 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | ethane;N-[(2-methyl-1,3-dioxoisoindol-5-yl)methyl]-4-(trifluoromethoxy)benzamide;(3R)-3-methylpiperidine-2,6-dione |
| SMILES | CC.CN1C(=O)c2ccc(CNC(=O)c3ccc(OC(F)(F)F)cc3)cc2C1=O.C[C@@H]1CCC(=O)NC1=O |
| InChI | InChI=1S/C18H13F3N2O4.C6H9NO2.C2H6/c1-23-16(25)13-7-2-10(8-14(13)17(23)26)9-22-15(24)11-3-5-12(6-4-11)27-18(19,20)21;1-4-2-3-5(8)7-6(4)9;1-2/h2-8H,9H2,1H3,(H,22,24);4H,2-3H2,1H3,(H,7,8,9);1-2H3/t;4-;/m.1./s1 |
| InChIKey | WTAXAOAXZUSGNB-NMABVXQLSA-N |
| XLogP | 3.83 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|