C20H23N5O2 — CID 144735899
6-amino-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbaldehyde;methanamine (PubChem CID 144735899) has the molecular formula C20H23N5O2 and a molecular weight of 365.44 g/mol. Its IUPAC name is 6-amino-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbaldehyde;methanamine.
| Compound Name | 6-amino-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 144735899 |
| Molecular Formula | C20H23N5O2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | 6-amino-2-(4-phenoxyphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbaldehyde;methanamine |
| SMILES | CN.NC1CNc2c(C=O)c(-c3ccc(Oc4ccccc4)cc3)nn2C1 |
| InChI | InChI=1S/C19H18N4O2.CH5N/c20-14-10-21-19-17(12-24)18(22-23(19)11-14)13-6-8-16(9-7-13)25-15-4-2-1-3-5-15;1-2/h1-9,12,14,21H,10-11,20H2;2H2,1H3 |
| InChIKey | SIVSUSINPUFECE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 108.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|