C24H26F3N5O3 — CID 144735998
difluoromethanol;N-[2-[2-(4-fluorophenyl)-3-formyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-7-yl]phenyl]prop-2-enamide;methanamine (PubChem CID 144735998) has the molecular formula C24H26F3N5O3 and a molecular weight of 489.50 g/mol. Its IUPAC name is difluoromethanol;N-[2-[2-(4-fluorophenyl)-3-formyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-7-yl]phenyl]prop-2-enamide;methanamine.
| Compound Name | difluoromethanol;N-[2-[2-(4-fluorophenyl)-3-formyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-7-yl]phenyl]prop-2-enamide;methanamine |
|---|---|
| PubChem CID | 144735998 |
| Molecular Formula | C24H26F3N5O3 |
| Molecular Weight | 489.50 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | difluoromethanol;N-[2-[2-(4-fluorophenyl)-3-formyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidin-7-yl]phenyl]prop-2-enamide;methanamine |
| SMILES | C=CC(=O)Nc1ccccc1C1CCNc2c(C=O)c(-c3ccc(F)cc3)nn21.CN.OC(F)F |
| InChI | InChI=1S/C22H19FN4O2.CH2F2O.CH5N/c1-2-20(29)25-18-6-4-3-5-16(18)19-11-12-24-22-17(13-28)21(26-27(19)22)14-7-9-15(23)10-8-14;2-1(3)4;1-2/h2-10,13,19,24H,1,11-12H2,(H,25,29);1,4H;2H2,1H3 |
| InChIKey | KUKBOEBPGHAJQC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.50 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|