C26H31N5O3 — CID 144736056
2-(3-methoxy-4-methylphenyl)-7-methyl-7-[2-(methylamino)phenyl]-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxamide;prop-2-enal (PubChem CID 144736056) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is 2-(3-methoxy-4-methylphenyl)-7-methyl-7-[2-(methylamino)phenyl]-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxamide;prop-2-enal.
| Compound Name | 2-(3-methoxy-4-methylphenyl)-7-methyl-7-[2-(methylamino)phenyl]-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxamide;prop-2-enal |
|---|---|
| PubChem CID | 144736056 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 2-(3-methoxy-4-methylphenyl)-7-methyl-7-[2-(methylamino)phenyl]-5,6-dihydro-4H-pyrazolo[1,5-a]pyrimidine-3-carboxamide;prop-2-enal |
| SMILES | C=CC=O.CNc1ccccc1C1(C)CCNc2c(C(N)=O)c(-c3ccc(C)c(OC)c3)nn21 |
| InChI | InChI=1S/C23H27N5O2.C3H4O/c1-14-9-10-15(13-18(14)30-4)20-19(21(24)29)22-26-12-11-23(2,28(22)27-20)16-7-5-6-8-17(16)25-3;1-2-3-4/h5-10,13,25-26H,11-12H2,1-4H3,(H2,24,29);2-3H,1H2 |
| InChIKey | ZQKLWRFQFZSGCJ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|