About 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline
2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline (PubChem CID 144738989) has the molecular formula C21H20N2O3
and a molecular weight of 348.40 g/mol. Its IUPAC name is 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline.
Molecular Properties
| Compound Name | 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline |
| PubChem CID | 144738989 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline |
| SMILES | CNc1cccc(C)c1COc1cccc(-c2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C21H20N2O3/c1-14-5-3-7-18(22-2)16(14)12-24-21-8-4-6-17(23-21)15-9-10-19-20(11-15)26-13-25-19/h3-11,22H,12-13H2,1-2H3 |
| InChIKey | NPXZGLMFFPNZRO-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline?
The IUPAC name of 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline (CID 144738989) is 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline.
What is the SMILES notation for 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline?
The canonical SMILES for 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline is CNc1cccc(C)c1COc1cccc(-c2ccc3c(c2)OCO3)n1.
What is the InChIKey of 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline?
The InChIKey is NPXZGLMFFPNZRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N2O3/c1-14-5-3-7-18(22-2)16(14)12-24-21-8-4-6-17(23-21)15-9-10-19-20(11-15)26-13-25-19/h3-11,22H,12-13H2,1-2H3.
What are the key properties of 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline?
2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline has a molecular weight of 348.40 g/mol, XLogP of 4.41, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-(1,3-benzodioxol-5-yl)-2-pyridinyl]oxymethyl]-N,3-dimethylaniline is sourced from PubChem (CID 144738989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).