C28H32N4O3 — CID 144739371
ethane;ethenamine;2-(4-imidazol-1-ylphenoxy)-N-[4-(2-methoxyphenyl)phenyl]acetamide (PubChem CID 144739371) has the molecular formula C28H32N4O3 and a molecular weight of 472.59 g/mol. Its IUPAC name is ethane;ethenamine;2-(4-imidazol-1-ylphenoxy)-N-[4-(2-methoxyphenyl)phenyl]acetamide.
| Compound Name | ethane;ethenamine;2-(4-imidazol-1-ylphenoxy)-N-[4-(2-methoxyphenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 144739371 |
| Molecular Formula | C28H32N4O3 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | ethane;ethenamine;2-(4-imidazol-1-ylphenoxy)-N-[4-(2-methoxyphenyl)phenyl]acetamide |
| SMILES | C=CN.CC.COc1ccccc1-c1ccc(NC(=O)COc2ccc(-n3ccnc3)cc2)cc1 |
| InChI | InChI=1S/C24H21N3O3.C2H5N.C2H6/c1-29-23-5-3-2-4-22(23)18-6-8-19(9-7-18)26-24(28)16-30-21-12-10-20(11-13-21)27-15-14-25-17-27;1-2-3;1-2/h2-15,17H,16H2,1H3,(H,26,28);2H,1,3H2;1-2H3 |
| InChIKey | JQOWHHWRPUDMPH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |