C24H25NO5 — CID 8745409
2-(4-ethoxyphenoxy)-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]acetamide (PubChem CID 8745409) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2-(4-ethoxyphenoxy)-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]acetamide.
| Compound Name | 2-(4-ethoxyphenoxy)-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8745409 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2-(4-ethoxyphenoxy)-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]acetamide |
| SMILES | CCOc1ccc(OCC(=O)Nc2ccc(OC)c(-c3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C24H25NO5/c1-4-29-20-10-12-21(13-11-20)30-16-24(26)25-18-7-14-23(28-3)22(15-18)17-5-8-19(27-2)9-6-17/h5-15H,4,16H2,1-3H3,(H,25,26) |
| InChIKey | OVHLGANVMAUIPF-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |