C22H20FNO3 — CID 8745498
2-(3-fluorophenyl)-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]acetamide (PubChem CID 8745498) has the molecular formula C22H20FNO3 and a molecular weight of 365.40 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]acetamide.
| Compound Name | 2-(3-fluorophenyl)-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8745498 |
| Molecular Formula | C22H20FNO3 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[4-methoxy-3-(4-methoxyphenyl)phenyl]acetamide |
| SMILES | COc1ccc(-c2cc(NC(=O)Cc3cccc(F)c3)ccc2OC)cc1 |
| InChI | InChI=1S/C22H20FNO3/c1-26-19-9-6-16(7-10-19)20-14-18(8-11-21(20)27-2)24-22(25)13-15-4-3-5-17(23)12-15/h3-12,14H,13H2,1-2H3,(H,24,25) |
| InChIKey | FENHSTHEAILVKX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |