C23H20F3NO3 — CID 8744983
N-[4-methoxy-3-(4-methoxyphenyl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 8744983) has the molecular formula C23H20F3NO3 and a molecular weight of 415.41 g/mol. Its IUPAC name is N-[4-methoxy-3-(4-methoxyphenyl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-[4-methoxy-3-(4-methoxyphenyl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 8744983 |
| Molecular Formula | C23H20F3NO3 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[4-methoxy-3-(4-methoxyphenyl)phenyl]-2-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | COc1ccc(-c2cc(NC(=O)Cc3cccc(C(F)(F)F)c3)ccc2OC)cc1 |
| InChI | InChI=1S/C23H20F3NO3/c1-29-19-9-6-16(7-10-19)20-14-18(8-11-21(20)30-2)27-22(28)13-15-4-3-5-17(12-15)23(24,25)26/h3-12,14H,13H2,1-2H3,(H,27,28) |
| InChIKey | OZLXRTXDHIFMCX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |