C19H21NO5 — CID 146134636
3-[4-methoxy-3-(4-methoxyphenyl)anilino]-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 146134636) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 3-[4-methoxy-3-(4-methoxyphenyl)anilino]-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-[4-methoxy-3-(4-methoxyphenyl)anilino]-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 146134636 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 3-[4-methoxy-3-(4-methoxyphenyl)anilino]-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | COc1ccc(-c2cc(NC(=O)C(C)(C)C(=O)O)ccc2OC)cc1 |
| InChI | InChI=1S/C19H21NO5/c1-19(2,18(22)23)17(21)20-13-7-10-16(25-4)15(11-13)12-5-8-14(24-3)9-6-12/h5-11H,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | JSVXEUTUAWXKLP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|