C19H24N4O2 — CID 144740210
[3-(6-amino-2-methylpyrimidin-4-yl)piperidin-1-yl]-(2-methoxy-4-methylphenyl)methanone (PubChem CID 144740210) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is [3-(6-amino-2-methylpyrimidin-4-yl)piperidin-1-yl]-(2-methoxy-4-methylphenyl)methanone.
| Compound Name | [3-(6-amino-2-methylpyrimidin-4-yl)piperidin-1-yl]-(2-methoxy-4-methylphenyl)methanone |
|---|---|
| PubChem CID | 144740210 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [3-(6-amino-2-methylpyrimidin-4-yl)piperidin-1-yl]-(2-methoxy-4-methylphenyl)methanone |
| SMILES | COc1cc(C)ccc1C(=O)N1CCCC(c2cc(N)nc(C)n2)C1 |
| InChI | InChI=1S/C19H24N4O2/c1-12-6-7-15(17(9-12)25-3)19(24)23-8-4-5-14(11-23)16-10-18(20)22-13(2)21-16/h6-7,9-10,14H,4-5,8,11H2,1-3H3,(H2,20,21,22) |
| InChIKey | TYCVDGNVEIFEJY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 81.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |