C20H33N3O — CID 144740267
[3-[(1Z)-1,3-diaminobuta-1,3-dienyl]pyrrolidin-1-yl]-phenylmethanone;ethane;propane (PubChem CID 144740267) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is [3-[(1Z)-1,3-diaminobuta-1,3-dienyl]pyrrolidin-1-yl]-phenylmethanone;ethane;propane.
| Compound Name | [3-[(1Z)-1,3-diaminobuta-1,3-dienyl]pyrrolidin-1-yl]-phenylmethanone;ethane;propane |
|---|---|
| PubChem CID | 144740267 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | [3-[(1Z)-1,3-diaminobuta-1,3-dienyl]pyrrolidin-1-yl]-phenylmethanone;ethane;propane |
| SMILES | C=C(N)/C=C(\N)C1CCN(C(=O)c2ccccc2)C1.CC.CCC |
| InChI | InChI=1S/C15H19N3O.C3H8.C2H6/c1-11(16)9-14(17)13-7-8-18(10-13)15(19)12-5-3-2-4-6-12;1-3-2;1-2/h2-6,9,13H,1,7-8,10,16-17H2;3H2,1-2H3;1-2H3/b14-9-;; |
| InChIKey | QBFMDQDXVTWCNN-SLYOBIJPSA-N |
| XLogP | 3.91 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|