C25H22N2O — CID 68630760
2-(1-benzoylpyrrolidin-3-yl)-2,2-diphenylacetonitrile (PubChem CID 68630760) has the molecular formula C25H22N2O and a molecular weight of 366.46 g/mol. Its IUPAC name is 2-(1-benzoylpyrrolidin-3-yl)-2,2-diphenylacetonitrile.
| Compound Name | 2-(1-benzoylpyrrolidin-3-yl)-2,2-diphenylacetonitrile |
|---|---|
| PubChem CID | 68630760 |
| Molecular Formula | C25H22N2O |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-(1-benzoylpyrrolidin-3-yl)-2,2-diphenylacetonitrile |
| SMILES | N#CC(c1ccccc1)(c1ccccc1)C1CCN(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C25H22N2O/c26-19-25(21-12-6-2-7-13-21,22-14-8-3-9-15-22)23-16-17-27(18-23)24(28)20-10-4-1-5-11-20/h1-15,23H,16-18H2 |
| InChIKey | SOQLHLLOGJVPME-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 44.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |