C23H35NO4 — CID 144740672
[(9S,14R)-8-amino-9-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] butanoate (PubChem CID 144740672) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is [(9S,14R)-8-amino-9-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] butanoate.
| Compound Name | [(9S,14R)-8-amino-9-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] butanoate |
|---|---|
| PubChem CID | 144740672 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | [(9S,14R)-8-amino-9-hydroxy-10,13-dimethyl-3-oxo-1,2,6,7,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] butanoate |
| SMILES | CCCC(=O)OC1CC[C@@H]2C1(C)CC[C@]1(O)C3(C)CCC(=O)C=C3CCC21N |
| InChI | InChI=1S/C23H35NO4/c1-4-5-19(26)28-18-7-6-17-20(18,2)12-13-23(27)21(3)10-9-16(25)14-15(21)8-11-22(17,23)24/h14,17-18,27H,4-13,24H2,1-3H3/t17-,18?,20?,21?,22?,23+/m1/s1 |
| InChIKey | CHFORGOJAIWLJO-DZETXDDLSA-N |
| XLogP | 3.43 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |