C20H22P+ — CID 144740709
methyl-(3-methylcyclohexa-1,5-dien-1-yl)-diphenylphosphanium (PubChem CID 144740709) has the molecular formula C20H22P+ and a molecular weight of 293.37 g/mol. Its IUPAC name is methyl-(3-methylcyclohexa-1,5-dien-1-yl)-diphenylphosphanium.
| Compound Name | methyl-(3-methylcyclohexa-1,5-dien-1-yl)-diphenylphosphanium |
|---|---|
| PubChem CID | 144740709 |
| Molecular Formula | C20H22P+ |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | methyl-(3-methylcyclohexa-1,5-dien-1-yl)-diphenylphosphanium |
| SMILES | CC1C=C([P+](C)(c2ccccc2)c2ccccc2)C=CC1 |
| InChI | InChI=1S/C20H22P/c1-17-10-9-15-20(16-17)21(2,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-9,11-17H,10H2,1-2H3/q+1 |
| InChIKey | MMBHUNZTTPANBY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|