C17H28O — CID 144742888
2-[(1R)-1-cyclobutylethyl]-6-propan-2-ylphenol;ethane (PubChem CID 144742888) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 2-[(1R)-1-cyclobutylethyl]-6-propan-2-ylphenol;ethane.
| Compound Name | 2-[(1R)-1-cyclobutylethyl]-6-propan-2-ylphenol;ethane |
|---|---|
| PubChem CID | 144742888 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 2-[(1R)-1-cyclobutylethyl]-6-propan-2-ylphenol;ethane |
| SMILES | CC.CC(C)c1cccc([C@H](C)C2CCC2)c1O |
| InChI | InChI=1S/C15H22O.C2H6/c1-10(2)13-8-5-9-14(15(13)16)11(3)12-6-4-7-12;1-2/h5,8-12,16H,4,6-7H2,1-3H3;1-2H3/t11-;/m1./s1 |
| InChIKey | MQYMOSLHLPCGLX-RFVHGSKJSA-N |
| XLogP | 5.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |