C30H35N9O5 — CID 144742924
4-[4-[[5-amino-4-[N-amino-4-[3-(1,3-dioxoisoindol-2-yl)propoxy]anilino]pyrimidin-2-yl]amino]pyrazol-1-yl]butanoic acid;ethane (PubChem CID 144742924) has the molecular formula C30H35N9O5 and a molecular weight of 601.67 g/mol. Its IUPAC name is 4-[4-[[5-amino-4-[N-amino-4-[3-(1,3-dioxoisoindol-2-yl)propoxy]anilino]pyrimidin-2-yl]amino]pyrazol-1-yl]butanoic acid;ethane.
| Compound Name | 4-[4-[[5-amino-4-[N-amino-4-[3-(1,3-dioxoisoindol-2-yl)propoxy]anilino]pyrimidin-2-yl]amino]pyrazol-1-yl]butanoic acid;ethane |
|---|---|
| PubChem CID | 144742924 |
| Molecular Formula | C30H35N9O5 |
| Molecular Weight | 601.67 g/mol |
| Exact Mass | 601.28 |
| IUPAC Name | 4-[4-[[5-amino-4-[N-amino-4-[3-(1,3-dioxoisoindol-2-yl)propoxy]anilino]pyrimidin-2-yl]amino]pyrazol-1-yl]butanoic acid;ethane |
| SMILES | CC.Nc1cnc(Nc2cnn(CCCC(=O)O)c2)nc1N(N)c1ccc(OCCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C28H29N9O5.C2H6/c29-23-16-31-28(33-18-15-32-35(17-18)12-3-7-24(38)39)34-25(23)37(30)19-8-10-20(11-9-19)42-14-4-13-36-26(40)21-5-1-2-6-22(21)27(36)41;1-2/h1-2,5-6,8-11,15-17H,3-4,7,12-14,29-30H2,(H,38,39)(H,31,33,34);1-2H3 |
| InChIKey | YNBZBNLOOSJNHE-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 194.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.67 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|