C17H15FN2O2 — CID 144743698
N-(4-fluoro-2,3-dihydro-1H-inden-1-yl)-N-(2-oxoethyl)pyridine-3-carboxamide (PubChem CID 144743698) has the molecular formula C17H15FN2O2 and a molecular weight of 298.32 g/mol. Its IUPAC name is N-(4-fluoro-2,3-dihydro-1H-inden-1-yl)-N-(2-oxoethyl)pyridine-3-carboxamide.
| Compound Name | N-(4-fluoro-2,3-dihydro-1H-inden-1-yl)-N-(2-oxoethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144743698 |
| Molecular Formula | C17H15FN2O2 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(4-fluoro-2,3-dihydro-1H-inden-1-yl)-N-(2-oxoethyl)pyridine-3-carboxamide |
| SMILES | O=CCN(C(=O)c1cccnc1)C1CCc2c(F)cccc21 |
| InChI | InChI=1S/C17H15FN2O2/c18-15-5-1-4-14-13(15)6-7-16(14)20(9-10-21)17(22)12-3-2-8-19-11-12/h1-5,8,10-11,16H,6-7,9H2 |
| InChIKey | JZOKBJKSFSBLDX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|