C25H26F3N3O2 — CID 144743643
benzene;methanamine;N-(2-oxoethyl)-N-[6-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]pyridine-3-carboxamide (PubChem CID 144743643) has the molecular formula C25H26F3N3O2 and a molecular weight of 457.50 g/mol. Its IUPAC name is benzene;methanamine;N-(2-oxoethyl)-N-[6-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]pyridine-3-carboxamide.
| Compound Name | benzene;methanamine;N-(2-oxoethyl)-N-[6-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144743643 |
| Molecular Formula | C25H26F3N3O2 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | benzene;methanamine;N-(2-oxoethyl)-N-[6-(trifluoromethyl)-2,3-dihydro-1H-inden-1-yl]pyridine-3-carboxamide |
| SMILES | CN.O=CCN(C(=O)c1cccnc1)C1CCc2ccc(C(F)(F)F)cc21.c1ccccc1 |
| InChI | InChI=1S/C18H15F3N2O2.C6H6.CH5N/c19-18(20,21)14-5-3-12-4-6-16(15(12)10-14)23(8-9-24)17(25)13-2-1-7-22-11-13;1-2-4-6-5-3-1;1-2/h1-3,5,7,9-11,16H,4,6,8H2;1-6H;2H2,1H3 |
| InChIKey | CHCTZCFMBQNMLT-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|