C23H19F6NO3 — CID 155181304
[3,5-bis(trifluoromethyl)phenyl]methyl N-methyl-N-[6-[(E)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamate (PubChem CID 155181304) has the molecular formula C23H19F6NO3 and a molecular weight of 471.40 g/mol. Its IUPAC name is [3,5-bis(trifluoromethyl)phenyl]methyl N-methyl-N-[6-[(E)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamate.
| Compound Name | [3,5-bis(trifluoromethyl)phenyl]methyl N-methyl-N-[6-[(E)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamate |
|---|---|
| PubChem CID | 155181304 |
| Molecular Formula | C23H19F6NO3 |
| Molecular Weight | 471.40 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | [3,5-bis(trifluoromethyl)phenyl]methyl N-methyl-N-[6-[(E)-3-oxoprop-1-enyl]-2,3-dihydro-1H-inden-1-yl]carbamate |
| SMILES | CN(C(=O)OCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)C1CCc2ccc(/C=C/C=O)cc21 |
| InChI | InChI=1S/C23H19F6NO3/c1-30(20-7-6-16-5-4-14(3-2-8-31)11-19(16)20)21(32)33-13-15-9-17(22(24,25)26)12-18(10-15)23(27,28)29/h2-5,8-12,20H,6-7,13H2,1H3/b3-2+ |
| InChIKey | QVTDGIGHDCYHCS-NSCUHMNNSA-N |
| XLogP | 6.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.40 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|