C25H24N4O2 — CID 144743772
2-amino-N-(2-amino-2-oxoethyl)-N-(6-cyano-2,3-dihydro-1H-inden-1-yl)benzamide;benzene (PubChem CID 144743772) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-amino-N-(2-amino-2-oxoethyl)-N-(6-cyano-2,3-dihydro-1H-inden-1-yl)benzamide;benzene.
| Compound Name | 2-amino-N-(2-amino-2-oxoethyl)-N-(6-cyano-2,3-dihydro-1H-inden-1-yl)benzamide;benzene |
|---|---|
| PubChem CID | 144743772 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-amino-N-(2-amino-2-oxoethyl)-N-(6-cyano-2,3-dihydro-1H-inden-1-yl)benzamide;benzene |
| SMILES | N#Cc1ccc2c(c1)C(N(CC(N)=O)C(=O)c1ccccc1N)CC2.c1ccccc1 |
| InChI | InChI=1S/C19H18N4O2.C6H6/c20-10-12-5-6-13-7-8-17(15(13)9-12)23(11-18(22)24)19(25)14-3-1-2-4-16(14)21;1-2-4-6-5-3-1/h1-6,9,17H,7-8,11,21H2,(H2,22,24);1-6H |
| InChIKey | RPCXNZCOXRWWLL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 113.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|