C26H26N6O2 — CID 144744137
[2-cyclopropyl-6-[(Z,5Z)-5-hydroxyiminohex-2-en-3-yl]-1H-benzimidazol-4-yl]-pyrazin-2-yl-pyridin-2-ylmethanol (PubChem CID 144744137) has the molecular formula C26H26N6O2 and a molecular weight of 454.53 g/mol. Its IUPAC name is [2-cyclopropyl-6-[(Z,5Z)-5-hydroxyiminohex-2-en-3-yl]-1H-benzimidazol-4-yl]-pyrazin-2-yl-pyridin-2-ylmethanol.
| Compound Name | [2-cyclopropyl-6-[(Z,5Z)-5-hydroxyiminohex-2-en-3-yl]-1H-benzimidazol-4-yl]-pyrazin-2-yl-pyridin-2-ylmethanol |
|---|---|
| PubChem CID | 144744137 |
| Molecular Formula | C26H26N6O2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | [2-cyclopropyl-6-[(Z,5Z)-5-hydroxyiminohex-2-en-3-yl]-1H-benzimidazol-4-yl]-pyrazin-2-yl-pyridin-2-ylmethanol |
| SMILES | C/C=C(/C/C(C)=N\O)c1cc(C(O)(c2ccccn2)c2cnccn2)c2nc(C3CC3)[nH]c2c1 |
| InChI | InChI=1S/C26H26N6O2/c1-3-17(12-16(2)32-34)19-13-20(24-21(14-19)30-25(31-24)18-7-8-18)26(33,22-6-4-5-9-28-22)23-15-27-10-11-29-23/h3-6,9-11,13-15,18,33-34H,7-8,12H2,1-2H3,(H,30,31)/b17-3-,32-16- |
| InChIKey | PUXGJEYDEIVQFP-DASMWFTCSA-N |
| XLogP | 4.55 |
| TPSA | 120.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|