C23H36F2N2O2 — CID 144747779
(3Z)-N-[2-(2,2-difluoropropoxy)ethyl]-4-imino-2-methyl-3-(4-propylheptylidene)cyclohexa-1,5-diene-1-carboxamide (PubChem CID 144747779) has the molecular formula C23H36F2N2O2 and a molecular weight of 410.55 g/mol. Its IUPAC name is (3Z)-N-[2-(2,2-difluoropropoxy)ethyl]-4-imino-2-methyl-3-(4-propylheptylidene)cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | (3Z)-N-[2-(2,2-difluoropropoxy)ethyl]-4-imino-2-methyl-3-(4-propylheptylidene)cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 144747779 |
| Molecular Formula | C23H36F2N2O2 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | (3Z)-N-[2-(2,2-difluoropropoxy)ethyl]-4-imino-2-methyl-3-(4-propylheptylidene)cyclohexa-1,5-diene-1-carboxamide |
| SMILES | [H]/N=C1\C=CC(C(=O)NCCOCC(C)(F)F)=C(C)\C1=C\CCC(CCC)CCC |
| InChI | InChI=1S/C23H36F2N2O2/c1-5-8-18(9-6-2)10-7-11-19-17(3)20(12-13-21(19)26)22(28)27-14-15-29-16-23(4,24)25/h11-13,18,26H,5-10,14-16H2,1-4H3,(H,27,28)/b19-11-,26-21+ |
| InChIKey | HGCFJPTYKQCSJR-QVYSAPQISA-N |
| XLogP | 5.60 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|