C22H35FN2O2 — CID 144747338
(3Z)-N-[2-(2-fluoroethoxy)ethyl]-4-imino-2-methyl-3-(4-propylheptylidene)cyclohexa-1,5-diene-1-carboxamide (PubChem CID 144747338) has the molecular formula C22H35FN2O2 and a molecular weight of 378.53 g/mol. Its IUPAC name is (3Z)-N-[2-(2-fluoroethoxy)ethyl]-4-imino-2-methyl-3-(4-propylheptylidene)cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | (3Z)-N-[2-(2-fluoroethoxy)ethyl]-4-imino-2-methyl-3-(4-propylheptylidene)cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 144747338 |
| Molecular Formula | C22H35FN2O2 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | (3Z)-N-[2-(2-fluoroethoxy)ethyl]-4-imino-2-methyl-3-(4-propylheptylidene)cyclohexa-1,5-diene-1-carboxamide |
| SMILES | [H]/N=C1\C=CC(C(=O)NCCOCCF)=C(C)\C1=C\CCC(CCC)CCC |
| InChI | InChI=1S/C22H35FN2O2/c1-4-7-18(8-5-2)9-6-10-19-17(3)20(11-12-21(19)24)22(26)25-14-16-27-15-13-23/h10-12,18,24H,4-9,13-16H2,1-3H3,(H,25,26)/b19-10-,24-21+ |
| InChIKey | QZDRTQNYDVGZCS-ZEGLZJJTSA-N |
| XLogP | 4.92 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|