C23H37NO2 — CID 144747505
(3E)-N-(2-ethoxyethyl)-2-methyl-4-methylidene-3-(4-propylheptylidene)cyclohexa-1,5-diene-1-carboxamide (PubChem CID 144747505) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is (3E)-N-(2-ethoxyethyl)-2-methyl-4-methylidene-3-(4-propylheptylidene)cyclohexa-1,5-diene-1-carboxamide.
| Compound Name | (3E)-N-(2-ethoxyethyl)-2-methyl-4-methylidene-3-(4-propylheptylidene)cyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 144747505 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | (3E)-N-(2-ethoxyethyl)-2-methyl-4-methylidene-3-(4-propylheptylidene)cyclohexa-1,5-diene-1-carboxamide |
| SMILES | C=c1ccc(C(=O)NCCOCC)c(C)/c1=C/CCC(CCC)CCC |
| InChI | InChI=1S/C23H37NO2/c1-6-10-20(11-7-2)12-9-13-21-18(4)14-15-22(19(21)5)23(25)24-16-17-26-8-3/h13-15,20H,4,6-12,16-17H2,1-3,5H3,(H,24,25)/b21-13+ |
| InChIKey | KINCIZOPACBBDQ-FYJGNVAPSA-N |
| XLogP | 3.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|